Brilliant Blue G, CAS [[6104-58-1]]
Artikelnummer:
APE-C5579-100G
Artikelname: |
Brilliant Blue G, CAS [[6104-58-1]] |
Artikelnummer: |
APE-C5579-100G |
Hersteller Artikelnummer: |
APE-C5579-100G |
Alternativnummer: |
APE-C5579-100G |
Hersteller: |
ApexBio |
Kategorie: |
Biochemikalien |
Alternative Synonym: |
Acid Blue 90,CBBG,Coomassie Brilliant Blue G-250,NSC 328382 |
used for protein staining in SDS-PAGE, Blue Native PAGE, and the Bradford Method, selective inhibitor of the P2X purinoceptor channel P2X7 |
Molekulargewicht: |
854 |
Reinheit: |
98.00% |
Sequenz: |
CC1=CC(N(CC)CC2=CC=CC(S(=O)([O-])=O)=C2)=CC=C1/C(C3=CC=C(NC4=CC=C(OCC)C=C4)C=C3)=C5C=C/C(C=C\5C)=[N+](CC6=CC=CC(S(=O)([O-])=O)=C6)/CC.[Na+] |
CAS Nummer: |
[6104-58-1] |
Formel: |
C47H48N3O7S2Na |