Angiotensin II HUMAN, CAS [[4474-91-3]]
Catalog Number:
APE-A1042-10MG
| Article Name: |
Angiotensin II HUMAN, CAS [[4474-91-3]] |
| Biozol Catalog Number: |
APE-A1042-10MG |
| Supplier Catalog Number: |
APE-A1042-10MG |
| Alternative Catalog Number: |
APE-A1042-10MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Asp-Arg-Val-Tyr-Ile-His-Pro-Phe |
| Potent vasopressor and a powerful stimulus for production and release of aldosterone from the adrenal cortex. |
| Molecular Weight: |
1046.2 |
| Purity: |
99.73% |
| Sequence: |
CCC(C)C(C(=O)NC(CC1=CN=CN1)C(=O)N2CCCC2C(=O)NC(CC3=CC=CC=C3)C(=O)O)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(C(C)C)NC(=O)C(CCCN=C(N)N)NC(=O)C(CC(=O)O)N.CC(=O)O |
| CAS Number: |
[4474-91-3] |
| Formula: |
C50H71N13O12 |
