signal transducer and activator of transcription 6 fragment
Catalog Number:
APE-A1090-1MG
| Article Name: |
signal transducer and activator of transcription 6 fragment |
| Biozol Catalog Number: |
APE-A1090-1MG |
| Supplier Catalog Number: |
APE-A1090-1MG |
| Alternative Catalog Number: |
APE-A1090-1MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
H2N-Ser-Tyr-Trp-Ser-Asp-Arg-Leu-Ile-Ile-OH |
| STAT6 transcription factor |
| Molecular Weight: |
1152.3 |
| Purity: |
99.79% |
| Sequence: |
OCC(N)C(NC(CC1=CC=C(O)C=C1)C(NC(CC2=CNC3=C2C=CC=C3)C(NC(CO)C(NC(CC(O)=O)C(NC(CCCNC(N)=N)C(NC(CC(C)C)C(NC(C(C)CC)C(NC(C(CC)C)C(O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| Formula: |
C54H81N13O15 |
