Luteinizing hormone releasing hormone human acetate salt (LHRH), CAS [[33515-09-2]]
Catalog Number:
APE-A1147-1MG
| Article Name: |
Luteinizing hormone releasing hormone human acetate salt (LHRH), CAS [[33515-09-2]] |
| Biozol Catalog Number: |
APE-A1147-1MG |
| Supplier Catalog Number: |
APE-A1147-1MG |
| Alternative Catalog Number: |
APE-A1147-1MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| acitivator of MMP-2 and MMP-9, selective |
| Molecular Weight: |
1182.29 |
| Purity: |
98.34% |
| Sequence: |
CC(C)CC(C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NCC(=O)N)NC(=O)CNC(=O)C(CC2=CC=C(C=C2)O)NC(=O)C(CO)NC(=O)C(CC3=CNC4=CC=CC=C43)NC(=O)C(CC5=CN=CN5)NC(=O)C6CCC(=O)N6 |
| CAS Number: |
[33515-09-2] |
| Formula: |
C55H75N17O13 |
