Trametinib (GSK1120212), CAS [[871700-17-3]]
Catalog Number:
APE-A3018-200MG
| Article Name: |
Trametinib (GSK1120212), CAS [[871700-17-3]] |
| Biozol Catalog Number: |
APE-A3018-200MG |
| Supplier Catalog Number: |
APE-A3018-200MG |
| Alternative Catalog Number: |
APE-A3018-200MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Trametinib, GSK-1120212, GSK1120212, Mekinist, JTP74057, JTP-74057 |
| MEK1 and MEK2 inhibitor, potent and selective |
| Molecular Weight: |
615.39 |
| Purity: |
98.14% |
| Sequence: |
CC1=C2C(=C(N(C1=O)C)NC3=C(C=C(C=C3)I)F)C(=O)N(C(=O)N2C4=CC(=CC=C4)NC(=O)C)C5CC5 |
| CAS Number: |
[871700-17-3] |
| Formula: |
C26H23FIN5O4 |
