2-HBA, CAS [[131359-24-5]]
Catalog Number:
APE-C3234-5MG
| Article Name: |
2-HBA, CAS [[131359-24-5]] |
| Biozol Catalog Number: |
APE-C3234-5MG |
| Supplier Catalog Number: |
APE-C3234-5MG |
| Alternative Catalog Number: |
APE-C3234-5MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Bis(2-hydroxybenzylidene)acetone |
| indirect inducer of enzymes that catalyze detoxification reactions through the Keap1-Nrf2-ARE pathway. |
| Molecular Weight: |
266.3 |
| Purity: |
98.00% |
| Sequence: |
OC1=C(/C=C/C(/C=C/C2=CC=CC=C2O)=O)C=CC=C1 |
| CAS Number: |
[131359-24-5] |
| Formula: |
C17H14O3 |
