Ethyl 3-Aminobenzoate (methanesulfonate), CAS [[886-86-2]]
Catalog Number:
APE-C3619-25G
| Article Name: |
Ethyl 3-Aminobenzoate (methanesulfonate), CAS [[886-86-2]] |
| Biozol Catalog Number: |
APE-C3619-25G |
| Supplier Catalog Number: |
APE-C3619-25G |
| Alternative Catalog Number: |
APE-C3619-25G |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
Ethyl m-Aminobenzoate|NSC 93790 |
| block the generation of action potentials through voltage-dependent Na+-channels |
| Molecular Weight: |
261.3 |
| Purity: |
99.88% |
| Sequence: |
O=C(OCC)C1=CC(N)=CC=C1.O=S(O)(C)=O |
| CAS Number: |
[886-86-2] |
| Formula: |
C9H11NO2CH4O3S |
