BM 567, CAS [[284464-77-3]]
Catalog Number:
APE-C3695-5MG
| Article Name: |
BM 567, CAS [[284464-77-3]] |
| Biozol Catalog Number: |
APE-C3695-5MG |
| Supplier Catalog Number: |
APE-C3695-5MG |
| Alternative Catalog Number: |
APE-C3695-5MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| dual acting antithrombogenic agent, acting as an inhibitor of thromboxane A2 (TXA2) synthase and as an antagonist of the TP receptor |
| Molecular Weight: |
412.5 |
| Purity: |
98.00% |
| Sequence: |
CCCCCNC(=O)NS(=O)(=O)c1cc(ccc1NC1CCCCC1)[N](=O)O |
| CAS Number: |
[284464-77-3] |
| Formula: |
C18H28N4O5S |
