PRL-3 Inhibitor, CAS [[893449-38-2]]
Catalog Number:
APE-C3996-5MG
| Article Name: |
PRL-3 Inhibitor, CAS [[893449-38-2]] |
| Biozol Catalog Number: |
APE-C3996-5MG |
| Supplier Catalog Number: |
APE-C3996-5MG |
| Alternative Catalog Number: |
APE-C3996-5MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
BR-1,P0108,Phosphatase of Regenerating Liver 3 Inhibitor,PTP4A3 Inhibitor |
| phosphatase of regenerating liver 3 (PRL-3) inhibitor |
| Molecular Weight: |
485.2 |
| Purity: |
98.00% |
| Sequence: |
BrC1=CC=C(OCC2=C(Br)C=CC=C2)C(/C=C3C(NC(S\3)=S)=O)=C1 |
| CAS Number: |
[893449-38-2] |
| Formula: |
C17H11Br2NO2S2 |
