Ethacrynic Acid, CAS [[58-54-8]]
Catalog Number:
APE-C4125-50MG
| Article Name: |
Ethacrynic Acid, CAS [[58-54-8]] |
| Biozol Catalog Number: |
APE-C4125-50MG |
| Supplier Catalog Number: |
APE-C4125-50MG |
| Alternative Catalog Number: |
APE-C4125-50MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
MK 595,NSC 85791,NSC 624008 |
| A loop diuretic that inhibits the Na+/K+/2Cl- cotransporter (NKCC2) |
| Molecular Weight: |
303.14 |
| Purity: |
98.35% |
| Sequence: |
O=C(O)COC1=CC=C(C(C(CC)=C)=O)C(Cl)=C1Cl |
| CAS Number: |
[58-54-8] |
| Formula: |
C13H12Cl2O4 |
