4-hydroxy Tamoxifen, CAS [[82413-23-8]]
Catalog Number:
APE-C4624-1MG
| Article Name: |
4-hydroxy Tamoxifen, CAS [[82413-23-8]] |
| Biozol Catalog Number: |
APE-C4624-1MG |
| Supplier Catalog Number: |
APE-C4624-1MG |
| Alternative Catalog Number: |
APE-C4624-1MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| metabolite of tamoxifen, an estrogen receptor modulator |
| Molecular Weight: |
387.5 |
| Purity: |
98% (may contain up to 10% of the (E) isomer) |
| Sequence: |
CC/C(C1=CC=C(O)C=C1)=C(C2=CC=CC=C2)/C3=CC=C(OCCN(C)C)C=C3 |
| CAS Number: |
[82413-23-8] |
| Formula: |
C26H29NO2 |
