SD 169, CAS [[1670-87-7]]
Catalog Number:
APE-C5850-10MG
| Article Name: |
SD 169, CAS [[1670-87-7]] |
| Biozol Catalog Number: |
APE-C5850-10MG |
| Supplier Catalog Number: |
APE-C5850-10MG |
| Alternative Catalog Number: |
APE-C5850-10MG |
| Manufacturer: |
ApexBio |
| Category: |
Biochemikalien |
| Alternative Names: |
5-Carbamoylindole |
| selective ATP competitive inhibitor of the MAP kinases p38alpha and p38beta |
| Molecular Weight: |
160.2 |
| Purity: |
97.00% |
| Sequence: |
NC(C1=CC=C(NC=C2)C2=C1)=O |
| CAS Number: |
[1670-87-7] |
| Formula: |
C9H8N2O |
