2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol (Mixture of diastereomers), CAS [[68751-57-5]] Preis auf Anfrage
Catalog Number:
TOR-B685525
| Article Name: |
2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol (Mixture of diastereomers), CAS [[68751-57-5]] Preis auf Anfrage |
| Biozol Catalog Number: |
TOR-B685525 |
| Supplier Catalog Number: |
B685525 |
| Alternative Catalog Number: |
TOR-B685525-100MG,TOR-B685525-1G,TOR-B685525-500MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1,3-Dioxolane-4-methanol, 2-(bromomethyl)-2-(2,4-dichlorophenyl)-, 2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolane-4-methanol, [2-(Bromomethyl)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol |
| Molecular Weight: |
342.01 |
| Sequence: |
OCC1COC(CBr)(O1)c2ccc(Cl)cc2Cl |
| CAS Number: |
[68751-57-5] |
| Formula: |
C11 H11 Br Cl2 O3 |
![]()
|
B685525 |
![]()
|
B685525 |
