DL-Phenyl-d5-alanine, CAS [[284664-89-7]]
Catalog Number:
TOR-D181216
- Images (3)
| Article Name: | DL-Phenyl-d5-alanine, CAS [[284664-89-7]] |
| Biozol Catalog Number: | TOR-D181216 |
| Supplier Catalog Number: | D181216 |
| Alternative Catalog Number: | TOR-D181216-100MG,TOR-D181216-10MG,TOR-D181216-50MG |
| Manufacturer: | Toronto Research Chemicals |
| Category: | Biochemikalien |
| Alternative Names: | Phenyl-d5-alanine (9CI) |
| Molecular Weight: | 170.22 |
| Form: | White to Off-White Solid |
| Sequence: | O=C(C(CC1=C([2H])C([2H])=C([2H])C([2H])=C1[2H])N)O |
| CAS Number: | [284664-89-7] |
| Formula: | C9H6D5NO2 |
|
|
D181216 |
|
|
D181216 |
|
|
D181216 |
Product Guarantee and Expert Support
