Decarboxy Gatifloxacin Dihydrochloride
Catalog Number:
TOR-D221500
- Images (3)
| Article Name: | Decarboxy Gatifloxacin Dihydrochloride |
| Biozol Catalog Number: | TOR-D221500 |
| Supplier Catalog Number: | D221500 |
| Alternative Catalog Number: | TOR-D221500-100MG,TOR-D221500-10MG |
| Manufacturer: | Toronto Research Chemicals |
| Category: | Biochemikalien |
| Alternative Names: | 1-Cyclopropyl-6-fluoro-8-methoxy-7-(3-methyl-1-piperazinyl)-4(1H)-quinolinone Dihydrochloride, |
| Molecular Weight: | 331.3923646 |
| Form: | Pale Yellow to Yellow Solid |
| Sequence: | FC1=CC(C(C=CN2C3CC3)=O)=C2C(OC)=C1N4CC(C)NCC4 |
| Formula: | C18H22FN3O2 2HCl |
|
|
D221500 |
|
|
D221500 |
|
|
D221500 |
Product Guarantee and Expert Support
