Desamino Glufosinate-d3, CAS [[1794938-71-8]] Preis auf Anfrage
Catalog Number:
TOR-D288462
- Images (3)
| Article Name: | Desamino Glufosinate-d3, CAS [[1794938-71-8]] Preis auf Anfrage |
| Biozol Catalog Number: | TOR-D288462 |
| Supplier Catalog Number: | D288462 |
| Alternative Catalog Number: | TOR-D288462-10MG,TOR-D288462-1MG |
| Manufacturer: | Toronto Research Chemicals |
| Category: | Biochemikalien |
| Alternative Names: | 4-(Hydroxy-(trideuteriomethyl)phosphoryl)butanoic acid |
| Molecular Weight: | 169.13 |
| Form: | White to Pale Beige Solid |
| Sequence: | C(CCC(O)=O)P(C([2H])([2H])[2H])(=O)O |
| CAS Number: | [1794938-71-8] |
| Formula: | C5H8D3O4P |
|
|
D288462 |
|
|
D288462 |
|
|
D288462 |
Product Guarantee and Expert Support
