3-Hydroxyglutaric Acid-d5, CAS [[1219805-72-7]]
Catalog Number:
TOR-H942582
- Images (3)
| Article Name: | 3-Hydroxyglutaric Acid-d5, CAS [[1219805-72-7]] |
| Biozol Catalog Number: | TOR-H942582 |
| Supplier Catalog Number: | H942582 |
| Alternative Catalog Number: | TOR-H942582-1G |
| Manufacturer: | Toronto Research Chemicals |
| Category: | Biochemikalien |
| Alternative Names: | 3-Hydroxy-pentanedioic Acid-d5, 2,4-Dideoxypentaric Acid-d5, beta-Hydroxyglutaric Acid-d5, |
| Molecular Weight: | 153.14 |
| Form: | White to Off-White Solid |
| Sequence: | OC(C([2H])([2H])C([2H])(O)C([2H])([2H])C(O)=O)=O |
| CAS Number: | [1219805-72-7] |
| Formula: | C5H3D5O5 |
|
|
H942582 |
|
|
H942582 |
|
|
H942582 |
Product Guarantee and Expert Support
