Zopiclone-d8 N-Oxide(Mixture of Diastereomers), CAS [[1215741-18-6]]
Catalog Number:
TOR-Z700512
| Article Name: |
Zopiclone-d8 N-Oxide(Mixture of Diastereomers), CAS [[1215741-18-6]] |
| Biozol Catalog Number: |
TOR-Z700512 |
| Supplier Catalog Number: |
Z700512 |
| Alternative Catalog Number: |
TOR-Z700512-10MG,TOR-Z700512-1MG |
| Manufacturer: |
Toronto Research Chemicals |
| Category: |
Biochemikalien |
| Alternative Names: |
1-Piperazine-d8-carboxylic Acid 4-Methyl-4-oxide 6-(5-Chloro-pyridin-2-yl)-7-oxo-6,7-dihydro-5H-pyrrolo[3,4-b]pyrazin-5yl Ester, RP 29753-d8 |
| Molecular Weight: |
412.86 |
| Sequence: |
[2H]C1([2H])N(C(=O)OC2N(C(=O)c3nccnc23)c4ccc(Cl)cn4)C([2H])([2H])C([2H])([2H])N(=O)(C)C1([2H])[2H] |
| CAS Number: |
[1215741-18-6] |
| Formula: |
C17 D8 H9 Cl N6 O4 |
![]()
|
Z700512 |
